Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
N,N-Dimethylallylamine, 98%
CAS: 2155-94-4 Molecular Formula: C5H11N Molecular Weight (g/mol): 85.15 MDL Number: MFCD00038234 InChI Key: GBCKRQRXNXQQPW-UHFFFAOYSA-N Synonym: n,n-dimethylallylamine,allyldimethylamine,dimethylallylamine,2-propen-1-amine, n,n-dimethyl,1-dimethylamino-2-propene,n-allyl-n,n-dimethylamine,n-allyldimethylamine,dimethyl prop-2-en-1-yl amine,allylamine, n,n-dimethyl,ch2=chch2n ch3 2 PubChem CID: 75082 IUPAC Name: N,N-dimethylprop-2-en-1-amine SMILES: CN(C)CC=C
| PubChem CID | 75082 |
|---|---|
| CAS | 2155-94-4 |
| Molecular Weight (g/mol) | 85.15 |
| MDL Number | MFCD00038234 |
| SMILES | CN(C)CC=C |
| Synonym | n,n-dimethylallylamine,allyldimethylamine,dimethylallylamine,2-propen-1-amine, n,n-dimethyl,1-dimethylamino-2-propene,n-allyl-n,n-dimethylamine,n-allyldimethylamine,dimethyl prop-2-en-1-yl amine,allylamine, n,n-dimethyl,ch2=chch2n ch3 2 |
| IUPAC Name | N,N-dimethylprop-2-en-1-amine |
| InChI Key | GBCKRQRXNXQQPW-UHFFFAOYSA-N |
| Molecular Formula | C5H11N |
Trimethylphosphine, 98%
CAS: 594-09-2 Molecular Formula: C3H9P Molecular Weight (g/mol): 76.079 MDL Number: MFCD00008510 InChI Key: YWWDBCBWQNCYNR-UHFFFAOYSA-N Synonym: trimethylphosphine,trimethyl phosphine,pme3,trimethylphosphorus,phosphine, trimethyl,me3p,ch3 3p,trimethylphospine,trimethylphosphine?,phosphine,trimethyl PubChem CID: 68983 ChEBI: CHEBI:35890 IUPAC Name: trimethylphosphane SMILES: CP(C)C
| PubChem CID | 68983 |
|---|---|
| CAS | 594-09-2 |
| Molecular Weight (g/mol) | 76.079 |
| ChEBI | CHEBI:35890 |
| MDL Number | MFCD00008510 |
| SMILES | CP(C)C |
| Synonym | trimethylphosphine,trimethyl phosphine,pme3,trimethylphosphorus,phosphine, trimethyl,me3p,ch3 3p,trimethylphospine,trimethylphosphine?,phosphine,trimethyl |
| IUPAC Name | trimethylphosphane |
| InChI Key | YWWDBCBWQNCYNR-UHFFFAOYSA-N |
| Molecular Formula | C3H9P |
1,3-Dioxolane, 99.8%, anhydrous, stabilized with 75 ppm BHT, AcroSeal™
CAS: 646-06-0 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 InChI Key: WNXJIVFYUVYPPR-UHFFFAOYSA-N Synonym: dioxolane,glycolformal,formal glycol,1,3-dioxolan,1,3-dioxacyclopentane,1,3-dioxalane,ethylene glycol formal,glycol methylene ether,glycol formal,dioxolan czech PubChem CID: 31404 ChEBI: CHEBI:34247 IUPAC Name: 2,6-ditert-butyl-4-methylphenol SMILES: CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C
| PubChem CID | 31404 |
|---|---|
| CAS | 646-06-0 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:34247 |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| Synonym | dioxolane,glycolformal,formal glycol,1,3-dioxolan,1,3-dioxacyclopentane,1,3-dioxalane,ethylene glycol formal,glycol methylene ether,glycol formal,dioxolan czech |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol |
| InChI Key | WNXJIVFYUVYPPR-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Activated charcoal, NORIT™ A SUPRA
CAS: 7440-44-0 Molecular Formula: C Molecular Weight (g/mol): 12 MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7440-44-0 |
| Molecular Weight (g/mol) | 12 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
(2-Hydroxyethyl)triphenylphosphonium bromide, 98+%
CAS: 7237-34-5 Molecular Formula: C20H20BrOP Molecular Weight (g/mol): 387.26 MDL Number: MFCD00011901 InChI Key: QZJOQNHOOVSESC-UHFFFAOYSA-M Synonym: 2-hydroxyethyl triphenylphosphonium bromide,2-hydroxyethyl triphenylphosphanium bromide,acmc-20appe,2-hydroxyethyltriphenylphosphonium bromide,2-hydroxyethyl triphenyphosphonium bromide,2-hydroxyethyl triphenyl phosphanium bromide,2-hydroxy ethyl triphenylphosphonium bromide,phosphonium, 2-hydroxyethyl triphenyl-,bromide 1:1,phosphonium, 2-hydroxyethyl triphenyl-, bromide 1:1 PubChem CID: 2733550 IUPAC Name: 2-hydroxyethyl(triphenyl)phosphanium;bromide SMILES: [Br-].OCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2733550 |
|---|---|
| CAS | 7237-34-5 |
| Molecular Weight (g/mol) | 387.26 |
| MDL Number | MFCD00011901 |
| SMILES | [Br-].OCC[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-hydroxyethyl triphenylphosphonium bromide,2-hydroxyethyl triphenylphosphanium bromide,acmc-20appe,2-hydroxyethyltriphenylphosphonium bromide,2-hydroxyethyl triphenyphosphonium bromide,2-hydroxyethyl triphenyl phosphanium bromide,2-hydroxy ethyl triphenylphosphonium bromide,phosphonium, 2-hydroxyethyl triphenyl-,bromide 1:1,phosphonium, 2-hydroxyethyl triphenyl-, bromide 1:1 |
| IUPAC Name | 2-hydroxyethyl(triphenyl)phosphanium;bromide |
| InChI Key | QZJOQNHOOVSESC-UHFFFAOYSA-M |
| Molecular Formula | C20H20BrOP |
Methyltriphenylphosphonium chloride, 97%, Thermo Scientific Chemicals
CAS: 1031-15-8 Molecular Formula: C19H18ClP Molecular Weight (g/mol): 312.78 MDL Number: MFCD00797851 InChI Key: QRPRIOOKPZSVFN-UHFFFAOYSA-M Synonym: methyltriphenylphosphonium chloride,methyl triphenyl phosphonium chloride,phosphonium, methyltriphenyl-, chloride,methyltriphenylphosphanium chloride,methyltriphenylphosphoniumchloride,methyl triphenylphosphoniumchloride,methyl triphenylphosphonium chloride,methyl triphenyl phosphanium chloride PubChem CID: 9879809 IUPAC Name: methyl(triphenyl)phosphanium;chloride SMILES: [Cl-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 9879809 |
|---|---|
| CAS | 1031-15-8 |
| Molecular Weight (g/mol) | 312.78 |
| MDL Number | MFCD00797851 |
| SMILES | [Cl-].C[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | methyltriphenylphosphonium chloride,methyl triphenyl phosphonium chloride,phosphonium, methyltriphenyl-, chloride,methyltriphenylphosphanium chloride,methyltriphenylphosphoniumchloride,methyl triphenylphosphoniumchloride,methyl triphenylphosphonium chloride,methyl triphenyl phosphanium chloride |
| IUPAC Name | methyl(triphenyl)phosphanium;chloride |
| InChI Key | QRPRIOOKPZSVFN-UHFFFAOYSA-M |
| Molecular Formula | C19H18ClP |
Sodium cyclopentadienide, 2-3M in THF
CAS: 4984-82-1 Molecular Formula: C5H5Na Molecular Weight (g/mol): 88.085 MDL Number: MFCD00012161 InChI Key: JQUZTGJSSQCTPV-UHFFFAOYSA-N Synonym: cyclopentadienylsodium,sodium cyclopenta-1,3-dien-1-ide,sodium cyclopentadienide, 2.0m solution in tetrahydrofuran PubChem CID: 21915903 IUPAC Name: sodium;cyclopenta-1,3-diene SMILES: C1C=CC=[C-]1.[Na+]
| PubChem CID | 21915903 |
|---|---|
| CAS | 4984-82-1 |
| Molecular Weight (g/mol) | 88.085 |
| MDL Number | MFCD00012161 |
| SMILES | C1C=CC=[C-]1.[Na+] |
| Synonym | cyclopentadienylsodium,sodium cyclopenta-1,3-dien-1-ide,sodium cyclopentadienide, 2.0m solution in tetrahydrofuran |
| IUPAC Name | sodium;cyclopenta-1,3-diene |
| InChI Key | JQUZTGJSSQCTPV-UHFFFAOYSA-N |
| Molecular Formula | C5H5Na |
Lithium tert-butoxide, 2.2M solution in THF, stabilized, AcroSeal™
CAS: 1907-33-1 Molecular Formula: C4H9LiO Molecular Weight (g/mol): 80.06 MDL Number: MFCD00050479 InChI Key: LZWQNOHZMQIFBX-UHFFFAOYSA-N Synonym: lithium tert-butoxide,lithium 2-methylpropan-2-olate,tert-butoxylithium,lithium tert-butylate,lithium tert-butanolate,tert-butyl alcohol, lithium salt,lithium t-butoxide,2-methyl-2-propanol lithium salt,2-propanol, 2-methyl-, lithium salt,lithium 1+ ion 2-methylpropan-2-olate PubChem CID: 23664764 IUPAC Name: lithium;2-methylpropan-2-olate SMILES: [Li+].CC(C)(C)[O-]
| PubChem CID | 23664764 |
|---|---|
| CAS | 1907-33-1 |
| Molecular Weight (g/mol) | 80.06 |
| MDL Number | MFCD00050479 |
| SMILES | [Li+].CC(C)(C)[O-] |
| Synonym | lithium tert-butoxide,lithium 2-methylpropan-2-olate,tert-butoxylithium,lithium tert-butylate,lithium tert-butanolate,tert-butyl alcohol, lithium salt,lithium t-butoxide,2-methyl-2-propanol lithium salt,2-propanol, 2-methyl-, lithium salt,lithium 1+ ion 2-methylpropan-2-olate |
| IUPAC Name | lithium;2-methylpropan-2-olate |
| InChI Key | LZWQNOHZMQIFBX-UHFFFAOYSA-N |
| Molecular Formula | C4H9LiO |
Diethyl oxalate, 99%
CAS: 95-92-1 Molecular Formula: C6H10O4 Molecular Weight (g/mol): 146.142 MDL Number: MFCD00009119 InChI Key: WYACBZDAHNBPPB-UHFFFAOYSA-N Synonym: ethyl oxalate,diethyl ethanedioate,ethanedioic acid, diethyl ester,oxalic acid, diethyl ester,oxalic ether,diethyloxalate,ethyl oxalate van,oxalic acid diethyl ester,unii-860m3zwf6j,diethylester kyseliny stavelove PubChem CID: 7268 IUPAC Name: diethyl oxalate SMILES: CCOC(=O)C(=O)OCC
| PubChem CID | 7268 |
|---|---|
| CAS | 95-92-1 |
| Molecular Weight (g/mol) | 146.142 |
| MDL Number | MFCD00009119 |
| SMILES | CCOC(=O)C(=O)OCC |
| Synonym | ethyl oxalate,diethyl ethanedioate,ethanedioic acid, diethyl ester,oxalic acid, diethyl ester,oxalic ether,diethyloxalate,ethyl oxalate van,oxalic acid diethyl ester,unii-860m3zwf6j,diethylester kyseliny stavelove |
| IUPAC Name | diethyl oxalate |
| InChI Key | WYACBZDAHNBPPB-UHFFFAOYSA-N |
| Molecular Formula | C6H10O4 |
Allyl methyl carbonate, 98%
CAS: 35466-83-2 Molecular Formula: C5H8O3 Molecular Weight (g/mol): 116.12 MDL Number: MFCD00134545 InChI Key: YHLVIDQQTOMBGN-UHFFFAOYSA-N Synonym: allyl methyl carbonate,methyl prop-2-en-1-yl carbonate,carbonic acid allyl methyl ester,isobutylene carbonate,methyl allyl carbonate,acmc-1agon,allyl methyl carbonate #,prop-2-enyl methoxyformate,yhlvidqqtombgn-uhfffaoysa PubChem CID: 534788 IUPAC Name: methyl prop-2-enyl carbonate SMILES: COC(=O)OCC=C
| PubChem CID | 534788 |
|---|---|
| CAS | 35466-83-2 |
| Molecular Weight (g/mol) | 116.12 |
| MDL Number | MFCD00134545 |
| SMILES | COC(=O)OCC=C |
| Synonym | allyl methyl carbonate,methyl prop-2-en-1-yl carbonate,carbonic acid allyl methyl ester,isobutylene carbonate,methyl allyl carbonate,acmc-1agon,allyl methyl carbonate #,prop-2-enyl methoxyformate,yhlvidqqtombgn-uhfffaoysa |
| IUPAC Name | methyl prop-2-enyl carbonate |
| InChI Key | YHLVIDQQTOMBGN-UHFFFAOYSA-N |
| Molecular Formula | C5H8O3 |
4-Bromobenzoyl chloride, 98+%
CAS: 586-75-4 Molecular Formula: C7H4BrClO Molecular Weight (g/mol): 219.46 MDL Number: MFCD00000683 InChI Key: DENKGPBHLYFNGK-UHFFFAOYSA-N Synonym: p-bromobenzoyl chloride,benzoyl chloride, 4-bromo,benzoyl chloride, p-bromo,4-bromobenzoylchloride,p-bromobenzoyl chloride, p-bromo,4-bromobenzoic acid chloride,p-brombenzoylchlorid,4bromobenzoyl chloride,p-brc6h4cocl,4-bromo-benzoylchloride PubChem CID: 68515 IUPAC Name: 4-bromobenzoyl chloride SMILES: ClC(=O)C1=CC=C(Br)C=C1
| PubChem CID | 68515 |
|---|---|
| CAS | 586-75-4 |
| Molecular Weight (g/mol) | 219.46 |
| MDL Number | MFCD00000683 |
| SMILES | ClC(=O)C1=CC=C(Br)C=C1 |
| Synonym | p-bromobenzoyl chloride,benzoyl chloride, 4-bromo,benzoyl chloride, p-bromo,4-bromobenzoylchloride,p-bromobenzoyl chloride, p-bromo,4-bromobenzoic acid chloride,p-brombenzoylchlorid,4bromobenzoyl chloride,p-brc6h4cocl,4-bromo-benzoylchloride |
| IUPAC Name | 4-bromobenzoyl chloride |
| InChI Key | DENKGPBHLYFNGK-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrClO |
tert-Butyldimethylsilyl trifluoromethanesulfonate, 98%
CAS: 69739-34-0 Molecular Formula: C7H15F3O3SSi Molecular Weight (g/mol): 264.33 MDL Number: MFCD00000405 InChI Key: WLLIXJBWWFGEHT-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate PubChem CID: 123564 IUPAC Name: [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate SMILES: CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F
| PubChem CID | 123564 |
|---|---|
| CAS | 69739-34-0 |
| Molecular Weight (g/mol) | 264.33 |
| MDL Number | MFCD00000405 |
| SMILES | CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| Synonym | tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate |
| IUPAC Name | [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate |
| InChI Key | WLLIXJBWWFGEHT-UHFFFAOYSA-N |
| Molecular Formula | C7H15F3O3SSi |
Acenaphthene, 99%
CAS: 83-32-9 Molecular Formula: C12H10 Molecular Weight (g/mol): 154.21 MDL Number: MFCD00003807 InChI Key: CWRYPZZKDGJXCA-UHFFFAOYSA-N Synonym: acenaphthene,1,8-ethylenenaphthalene,naphthyleneethylene,peri-ethylenenaphthalene,acenaphthylene, 1,2-dihydro,ethylenenaphthalene,1,8-dihydroacenaphthalene,unii-v8ut1gac5y,ccris 5951,v8ut1gac5y PubChem CID: 6734 ChEBI: CHEBI:22154 IUPAC Name: 1,2-dihydroacenaphthylene SMILES: C1CC2=C3C1=CC=CC3=CC=C2
| PubChem CID | 6734 |
|---|---|
| CAS | 83-32-9 |
| Molecular Weight (g/mol) | 154.21 |
| ChEBI | CHEBI:22154 |
| MDL Number | MFCD00003807 |
| SMILES | C1CC2=C3C1=CC=CC3=CC=C2 |
| Synonym | acenaphthene,1,8-ethylenenaphthalene,naphthyleneethylene,peri-ethylenenaphthalene,acenaphthylene, 1,2-dihydro,ethylenenaphthalene,1,8-dihydroacenaphthalene,unii-v8ut1gac5y,ccris 5951,v8ut1gac5y |
| IUPAC Name | 1,2-dihydroacenaphthylene |
| InChI Key | CWRYPZZKDGJXCA-UHFFFAOYSA-N |
| Molecular Formula | C12H10 |
Lidocaine Hydrochloride, MP Biomedicals
CAS: 6108-05-0 Molecular Formula: C14H25ClN2O2 Molecular Weight (g/mol): 288.82 MDL Number: MFCD00150329 InChI Key: YECIFGHRMFEPJK-UHFFFAOYSA-N Synonym: lidocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride hydrate,dolicaine,linocaine hydrochloride,lidocaine hydrochloride hydrate,xylocaine hydrochloride monohydrate,lignocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride monohydrate,zingo tm,lidocaine hcl hydrate PubChem CID: 16219577 ChEBI: CHEBI:60791 SMILES: O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C
| PubChem CID | 16219577 |
|---|---|
| CAS | 6108-05-0 |
| Molecular Weight (g/mol) | 288.82 |
| ChEBI | CHEBI:60791 |
| MDL Number | MFCD00150329 |
| SMILES | O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C |
| Synonym | lidocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride hydrate,dolicaine,linocaine hydrochloride,lidocaine hydrochloride hydrate,xylocaine hydrochloride monohydrate,lignocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride monohydrate,zingo tm,lidocaine hcl hydrate |
| InChI Key | YECIFGHRMFEPJK-UHFFFAOYSA-N |
| Molecular Formula | C14H25ClN2O2 |
Dextran sulfate sodium salt, MW ca >500,000
CAS: 9011-18-1 Molecular Formula: (C6H7O5)m(C6H7O5)n Molecular Weight (g/mol): 40,000 MDL Number: MFCD00081551 InChI Key: BLFLLBZGZJTVJG-UHFFFAOYSA-N Synonym: benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin PubChem CID: 2337 ChEBI: CHEBI:116735 SMILES: *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*]
| PubChem CID | 2337 |
|---|---|
| CAS | 9011-18-1 |
| Molecular Weight (g/mol) | 40,000 |
| ChEBI | CHEBI:116735 |
| MDL Number | MFCD00081551 |
| SMILES | *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*] |
| Synonym | benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin |
| InChI Key | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Molecular Formula | (C6H7O5)m(C6H7O5)n |